C10H13N3O2 — CID 3041224
1,3-diethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 3041224) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1,3-diethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-diethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3041224 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1,3-diethyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c2cc[nH]c2n(CC)c1=O |
| InChI | InChI=1S/C10H13N3O2/c1-3-12-8-7(5-6-11-8)9(14)13(4-2)10(12)15/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | UWZMYTIVXOEQDV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |