About (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol
(3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol (PubChem CID 3041256) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol.
Molecular Properties
| Compound Name | (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol |
| PubChem CID | 3041256 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol |
| SMILES | CC[C@H](O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20,23H,5,16H2,1-4H3/t17-,20-/m0/s1 |
| InChIKey | QIRAYNIFEOXSPW-PXNSSMCTSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol?
The IUPAC name of (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol (CID 3041256) is (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol.
What is the SMILES notation for (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol?
The canonical SMILES for (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol is CC[C@H](O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol?
The InChIKey is QIRAYNIFEOXSPW-PXNSSMCTSA-N. The full InChI is InChI=1S/C21H29NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17,20,23H,5,16H2,1-4H3/t17-,20-/m0/s1.
What are the key properties of (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol?
(3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol has a molecular weight of 311.47 g/mol, XLogP of 4.08, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6S)-6-(dimethylamino)-4,4-diphenylheptan-3-ol is sourced from PubChem (CID 3041256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).