About bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid
bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid (PubChem CID 3041258) has the molecular formula C40H50N2O6S2
and a molecular weight of 718.98 g/mol. Its IUPAC name is bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid.
Molecular Properties
| Compound Name | bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid |
| PubChem CID | 3041258 |
| Molecular Formula | C40H50N2O6S2 |
| Molecular Weight | 718.98 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid |
| SMILES | CC(C)=C1CN(C)CCC1c1ccccc1.CC(C)=C1CN(C)CCC1c1ccccc1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/2C15H21N.C10H8O6S2/c2*1-12(2)15-11-16(3)10-9-14(15)13-7-5-4-6-8-13;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h2*4-8,14H,9-11H2,1-3H3;1-6H,(H,11,12,13)(H,14,15,16) |
| InChIKey | MMMVWMJMJMXJID-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 718.98 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid?
The IUPAC name of bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid (CID 3041258) is bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid.
What is the SMILES notation for bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid?
The canonical SMILES for bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid is CC(C)=C1CN(C)CCC1c1ccccc1.CC(C)=C1CN(C)CCC1c1ccccc1.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12.
What is the InChIKey of bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid?
The InChIKey is MMMVWMJMJMXJID-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H21N.C10H8O6S2/c2*1-12(2)15-11-16(3)10-9-14(15)13-7-5-4-6-8-13;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h2*4-8,14H,9-11H2,1-3H3;1-6H,(H,11,12,13)(H,14,15,16).
What are the key properties of bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid?
bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid has a molecular weight of 718.98 g/mol, XLogP of 8.22, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-methyl-4-phenyl-3-propan-2-ylidenepiperidine);naphthalene-1,5-disulfonic acid is sourced from PubChem (CID 3041258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).