C41H54N4O — CID 3041262
1,7-bis[di(propan-2-yl)amino]-3,5-diphenyl-3,5-dipyridin-2-ylheptan-4-one (PubChem CID 3041262) has the molecular formula C41H54N4O and a molecular weight of 618.91 g/mol. Its IUPAC name is 1,7-bis[di(propan-2-yl)amino]-3,5-diphenyl-3,5-dipyridin-2-ylheptan-4-one.
| Compound Name | 1,7-bis[di(propan-2-yl)amino]-3,5-diphenyl-3,5-dipyridin-2-ylheptan-4-one |
|---|---|
| PubChem CID | 3041262 |
| Molecular Formula | C41H54N4O |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.43 |
| IUPAC Name | 1,7-bis[di(propan-2-yl)amino]-3,5-diphenyl-3,5-dipyridin-2-ylheptan-4-one |
| SMILES | CC(C)N(CCC(C(=O)C(CCN(C(C)C)C(C)C)(c1ccccc1)c1ccccn1)(c1ccccc1)c1ccccn1)C(C)C |
| InChI | InChI=1S/C41H54N4O/c1-31(2)44(32(3)4)29-25-40(35-19-11-9-12-20-35,37-23-15-17-27-42-37)39(46)41(36-21-13-10-14-22-36,38-24-16-18-28-43-38)26-30-45(33(5)6)34(7)8/h9-24,27-28,31-34H,25-26,29-30H2,1-8H3 |
| InChIKey | YXKOIBYNUMLJAP-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |