About 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane
1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane (PubChem CID 3041329) has the molecular formula C5H8Br2Cl6
and a molecular weight of 440.65 g/mol. Its IUPAC name is 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane.
Molecular Properties
| Compound Name | 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane |
| PubChem CID | 3041329 |
| Molecular Formula | C5H8Br2Cl6 |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 435.71 |
| IUPAC Name | 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane |
| SMILES | BrCCBr.ClC(Cl)(Cl)Cl.ClCCCl |
| InChI | InChI=1S/C2H4Br2.C2H4Cl2.CCl4/c2*3-1-2-4;2-1(3,4)5/h2*1-2H2; |
| InChIKey | QXGMFEYBTCJIFL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane?
The IUPAC name of 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane (CID 3041329) is 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane.
What is the SMILES notation for 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane?
The canonical SMILES for 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane is BrCCBr.ClC(Cl)(Cl)Cl.ClCCCl.
What is the InChIKey of 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane?
The InChIKey is QXGMFEYBTCJIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Br2.C2H4Cl2.CCl4/c2*3-1-2-4;2-1(3,4)5/h2*1-2H2;.
What are the key properties of 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane?
1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane has a molecular weight of 440.65 g/mol, XLogP of 5.79, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromoethane;1,2-dichloroethane;tetrachloromethane is sourced from PubChem (CID 3041329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).