About 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride
5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride (PubChem CID 3041335) has the molecular formula C14H15ClFNS
and a molecular weight of 283.80 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride |
| PubChem CID | 3041335 |
| Molecular Formula | C14H15ClFNS |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride |
| SMILES | Cl.Fc1ccc(CN2CCc3sccc3C2)cc1 |
| InChI | InChI=1S/C14H14FNS.ClH/c15-13-3-1-11(2-4-13)9-16-7-5-14-12(10-16)6-8-17-14;/h1-4,6,8H,5,7,9-10H2;1H |
| InChIKey | HZVXVAJTJPEBQY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride?
The IUPAC name of 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride (CID 3041335) is 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride.
What is the SMILES notation for 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride?
The canonical SMILES for 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride is Cl.Fc1ccc(CN2CCc3sccc3C2)cc1.
What is the InChIKey of 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride?
The InChIKey is HZVXVAJTJPEBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNS.ClH/c15-13-3-1-11(2-4-13)9-16-7-5-14-12(10-16)6-8-17-14;/h1-4,6,8H,5,7,9-10H2;1H.
What are the key properties of 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride?
5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride has a molecular weight of 283.80 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-fluorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine;hydrochloride is sourced from PubChem (CID 3041335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).