About [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol
[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol (PubChem CID 3041364) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol |
| PubChem CID | 3041364 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol |
| SMILES | Cc1cccc(-c2nnc(CO)o2)c1 |
| InChI | InChI=1S/C10H10N2O2/c1-7-3-2-4-8(5-7)10-12-11-9(6-13)14-10/h2-5,13H,6H2,1H3 |
| InChIKey | HCMBDGSFVLBUGU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol?
The IUPAC name of [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol (CID 3041364) is [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol.
What is the SMILES notation for [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol?
The canonical SMILES for [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol is Cc1cccc(-c2nnc(CO)o2)c1.
What is the InChIKey of [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol?
The InChIKey is HCMBDGSFVLBUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-7-3-2-4-8(5-7)10-12-11-9(6-13)14-10/h2-5,13H,6H2,1H3.
What are the key properties of [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol?
[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol has a molecular weight of 190.20 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol is sourced from PubChem (CID 3041364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).