About 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride
7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride (PubChem CID 3041600) has the molecular formula C10H14ClNO2
and a molecular weight of 215.68 g/mol. Its IUPAC name is 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| PubChem CID | 3041600 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| SMILES | COc1ccc2c(c1)OCC(N)C2.Cl |
| InChI | InChI=1S/C10H13NO2.ClH/c1-12-9-3-2-7-4-8(11)6-13-10(7)5-9;/h2-3,5,8H,4,6,11H2,1H3;1H |
| InChIKey | MEDKKMCXWLRRSU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The IUPAC name of 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride (CID 3041600) is 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
What is the SMILES notation for 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The canonical SMILES for 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride is COc1ccc2c(c1)OCC(N)C2.Cl.
What is the InChIKey of 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The InChIKey is MEDKKMCXWLRRSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.ClH/c1-12-9-3-2-7-4-8(11)6-13-10(7)5-9;/h2-3,5,8H,4,6,11H2,1H3;1H.
What are the key properties of 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride has a molecular weight of 215.68 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride is sourced from PubChem (CID 3041600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).