C14H16N4O4 — CID 3041661
N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-morpholin-4-ylacetamide (PubChem CID 3041661) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-morpholin-4-ylacetamide.
| Compound Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 3041661 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C14H16N4O4/c19-11(8-18-4-6-22-7-5-18)15-10-3-1-2-9-12(10)14(21)17-16-13(9)20/h1-3H,4-8H2,(H,15,19)(H,16,20)(H,17,21) |
| InChIKey | HUPLKFHCNLHSKZ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |