About hydron;2-methylpropan-1-amine
hydron;2-methylpropan-1-amine (PubChem CID 3041751) has the molecular formula C4H12N+
and a molecular weight of 74.15 g/mol. Its IUPAC name is hydron;2-methylpropan-1-amine.
Molecular Properties
| Compound Name | hydron;2-methylpropan-1-amine |
| PubChem CID | 3041751 |
| Molecular Formula | C4H12N+ |
| Molecular Weight | 74.15 g/mol |
| Exact Mass | 74.10 |
| IUPAC Name | hydron;2-methylpropan-1-amine |
| SMILES | CC(C)CN.[H+] |
| InChI | InChI=1S/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3/p+1 |
| InChIKey | KDSNLYIMUZNERS-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze hydron;2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-methylpropan-1-amine?
The IUPAC name of hydron;2-methylpropan-1-amine (CID 3041751) is hydron;2-methylpropan-1-amine.
What is the SMILES notation for hydron;2-methylpropan-1-amine?
The canonical SMILES for hydron;2-methylpropan-1-amine is CC(C)CN.[H+].
What is the InChIKey of hydron;2-methylpropan-1-amine?
The InChIKey is KDSNLYIMUZNERS-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H11N/c1-4(2)3-5/h4H,3,5H2,1-2H3/p+1.
What are the key properties of hydron;2-methylpropan-1-amine?
hydron;2-methylpropan-1-amine has a molecular weight of 74.15 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-methylpropan-1-amine is sourced from PubChem (CID 3041751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).