About 2-(diethylamino)ethyl 4,4-dimethylpentanoate
2-(diethylamino)ethyl 4,4-dimethylpentanoate (PubChem CID 3041814) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 4,4-dimethylpentanoate |
| PubChem CID | 3041814 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-(diethylamino)ethyl 4,4-dimethylpentanoate |
| SMILES | CCN(CC)CCOC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C13H27NO2/c1-6-14(7-2)10-11-16-12(15)8-9-13(3,4)5/h6-11H2,1-5H3 |
| InChIKey | OLUYFRLJSVIINC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 4,4-dimethylpentanoate?
The IUPAC name of 2-(diethylamino)ethyl 4,4-dimethylpentanoate (CID 3041814) is 2-(diethylamino)ethyl 4,4-dimethylpentanoate.
What is the SMILES notation for 2-(diethylamino)ethyl 4,4-dimethylpentanoate?
The canonical SMILES for 2-(diethylamino)ethyl 4,4-dimethylpentanoate is CCN(CC)CCOC(=O)CCC(C)(C)C.
What is the InChIKey of 2-(diethylamino)ethyl 4,4-dimethylpentanoate?
The InChIKey is OLUYFRLJSVIINC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-6-14(7-2)10-11-16-12(15)8-9-13(3,4)5/h6-11H2,1-5H3.
What are the key properties of 2-(diethylamino)ethyl 4,4-dimethylpentanoate?
2-(diethylamino)ethyl 4,4-dimethylpentanoate has a molecular weight of 229.36 g/mol, XLogP of 2.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 4,4-dimethylpentanoate is sourced from PubChem (CID 3041814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).