About 4-propylheptanamide
4-propylheptanamide (PubChem CID 3041945) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 4-propylheptanamide.
Molecular Properties
| Compound Name | 4-propylheptanamide |
| PubChem CID | 3041945 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 4-propylheptanamide |
| SMILES | CCCC(CCC)CCC(N)=O |
| InChI | InChI=1S/C10H21NO/c1-3-5-9(6-4-2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H2,11,12) |
| InChIKey | HCMKEJFDFDFAHN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-propylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylheptanamide?
The IUPAC name of 4-propylheptanamide (CID 3041945) is 4-propylheptanamide.
What is the SMILES notation for 4-propylheptanamide?
The canonical SMILES for 4-propylheptanamide is CCCC(CCC)CCC(N)=O.
What is the InChIKey of 4-propylheptanamide?
The InChIKey is HCMKEJFDFDFAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-3-5-9(6-4-2)7-8-10(11)12/h9H,3-8H2,1-2H3,(H2,11,12).
What are the key properties of 4-propylheptanamide?
4-propylheptanamide has a molecular weight of 171.28 g/mol, XLogP of 2.47, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylheptanamide is sourced from PubChem (CID 3041945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).