About 3-propylhex-2-enamide
3-propylhex-2-enamide (PubChem CID 3041946) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is 3-propylhex-2-enamide.
Molecular Properties
| Compound Name | 3-propylhex-2-enamide |
| PubChem CID | 3041946 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 3-propylhex-2-enamide |
| SMILES | CCCC(=CC(N)=O)CCC |
| InChI | InChI=1S/C9H17NO/c1-3-5-8(6-4-2)7-9(10)11/h7H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | NHMYHAJXJQVPIO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-propylhex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylhex-2-enamide?
The IUPAC name of 3-propylhex-2-enamide (CID 3041946) is 3-propylhex-2-enamide.
What is the SMILES notation for 3-propylhex-2-enamide?
The canonical SMILES for 3-propylhex-2-enamide is CCCC(=CC(N)=O)CCC.
What is the InChIKey of 3-propylhex-2-enamide?
The InChIKey is NHMYHAJXJQVPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO/c1-3-5-8(6-4-2)7-9(10)11/h7H,3-6H2,1-2H3,(H2,10,11).
What are the key properties of 3-propylhex-2-enamide?
3-propylhex-2-enamide has a molecular weight of 155.24 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylhex-2-enamide is sourced from PubChem (CID 3041946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).