C12H20F3N7 — CID 3041967
2-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 3041967) has the molecular formula C12H20F3N7 and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3041967 |
| Molecular Formula | C12H20F3N7 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-N-[3-(4-methylpiperazin-1-yl)propyl]-6-(trifluoromethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN1CCN(CCCNc2nc(N)nc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C12H20F3N7/c1-21-5-7-22(8-6-21)4-2-3-17-11-19-9(12(13,14)15)18-10(16)20-11/h2-8H2,1H3,(H3,16,17,18,19,20) |
| InChIKey | LLXVLVYLHQHAOZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|