About 2-methyl-4-phenyl-6H-1,3,5-oxathiazine
2-methyl-4-phenyl-6H-1,3,5-oxathiazine (PubChem CID 3042018) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-methyl-4-phenyl-6H-1,3,5-oxathiazine.
Molecular Properties
| Compound Name | 2-methyl-4-phenyl-6H-1,3,5-oxathiazine |
| PubChem CID | 3042018 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-methyl-4-phenyl-6H-1,3,5-oxathiazine |
| SMILES | CC1OCN=C(c2ccccc2)S1 |
| InChI | InChI=1S/C10H11NOS/c1-8-12-7-11-10(13-8)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | MXBIMNXDAMOVRF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-phenyl-6H-1,3,5-oxathiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenyl-6H-1,3,5-oxathiazine?
The IUPAC name of 2-methyl-4-phenyl-6H-1,3,5-oxathiazine (CID 3042018) is 2-methyl-4-phenyl-6H-1,3,5-oxathiazine.
What is the SMILES notation for 2-methyl-4-phenyl-6H-1,3,5-oxathiazine?
The canonical SMILES for 2-methyl-4-phenyl-6H-1,3,5-oxathiazine is CC1OCN=C(c2ccccc2)S1.
What is the InChIKey of 2-methyl-4-phenyl-6H-1,3,5-oxathiazine?
The InChIKey is MXBIMNXDAMOVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c1-8-12-7-11-10(13-8)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
What are the key properties of 2-methyl-4-phenyl-6H-1,3,5-oxathiazine?
2-methyl-4-phenyl-6H-1,3,5-oxathiazine has a molecular weight of 193.27 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenyl-6H-1,3,5-oxathiazine is sourced from PubChem (CID 3042018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).