About 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol (PubChem CID 3042019) has the molecular formula C15H17N5O5
and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol |
| PubChem CID | 3042019 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O.OCc1cccnc1 |
| InChI | InChI=1S/C9H10N4O4.C6H7NO/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15;8-5-6-2-1-3-7-4-6/h4H,3H2,1-2H3,(H,14,15);1-4,8H,5H2 |
| InChIKey | IANMPXCZCSTLIG-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol?
The IUPAC name of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol (CID 3042019) is 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol.
What is the SMILES notation for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol?
The canonical SMILES for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol is Cn1c(=O)c2c(ncn2CC(=O)O)n(C)c1=O.OCc1cccnc1.
What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol?
The InChIKey is IANMPXCZCSTLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O4.C6H7NO/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15;8-5-6-2-1-3-7-4-6/h4H,3H2,1-2H3,(H,14,15);1-4,8H,5H2.
What are the key properties of 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol?
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol has a molecular weight of 347.33 g/mol, XLogP of -0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid;pyridin-3-ylmethanol is sourced from PubChem (CID 3042019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).