C13H18BrNO2 — CID 3042044
2-methyl-1,3,4,7,8,9-hexahydrocyclopenta[h]isoquinoline-5,6-diol;hydrobromide (PubChem CID 3042044) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-methyl-1,3,4,7,8,9-hexahydrocyclopenta[h]isoquinoline-5,6-diol;hydrobromide.
| Compound Name | 2-methyl-1,3,4,7,8,9-hexahydrocyclopenta[h]isoquinoline-5,6-diol;hydrobromide |
|---|---|
| PubChem CID | 3042044 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-methyl-1,3,4,7,8,9-hexahydrocyclopenta[h]isoquinoline-5,6-diol;hydrobromide |
| SMILES | Br.CN1CCc2c(O)c(O)c3c(c2C1)CCC3 |
| InChI | InChI=1S/C13H17NO2.BrH/c1-14-6-5-10-11(7-14)8-3-2-4-9(8)12(15)13(10)16;/h15-16H,2-7H2,1H3;1H |
| InChIKey | WUEHOHWJGVGPBX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|