About 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride
1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride (PubChem CID 3042072) has the molecular formula C14H19ClN2O
and a molecular weight of 266.77 g/mol. Its IUPAC name is 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride |
| PubChem CID | 3042072 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride |
| SMILES | CCN1CCC2(C1)C(=O)Nc1c(C)cccc12.Cl |
| InChI | InChI=1S/C14H18N2O.ClH/c1-3-16-8-7-14(9-16)11-6-4-5-10(2)12(11)15-13(14)17;/h4-6H,3,7-9H2,1-2H3,(H,15,17);1H |
| InChIKey | PNOSGEDRDWHLQQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride?
The IUPAC name of 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride (CID 3042072) is 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride.
What is the SMILES notation for 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride?
The canonical SMILES for 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride is CCN1CCC2(C1)C(=O)Nc1c(C)cccc12.Cl.
What is the InChIKey of 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride?
The InChIKey is PNOSGEDRDWHLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O.ClH/c1-3-16-8-7-14(9-16)11-6-4-5-10(2)12(11)15-13(14)17;/h4-6H,3,7-9H2,1-2H3,(H,15,17);1H.
What are the key properties of 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride?
1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride has a molecular weight of 266.77 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-ethyl-7-methylspiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride is sourced from PubChem (CID 3042072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).