About N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide
N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide (PubChem CID 3042083) has the molecular formula C20H21Cl2N3O
and a molecular weight of 390.31 g/mol. Its IUPAC name is N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide.
Molecular Properties
| Compound Name | N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide |
| PubChem CID | 3042083 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCCCNC(=O)N1CC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C20H21Cl2N3O/c1-2-3-12-23-20(26)25-13-18(14-4-8-16(21)9-5-14)19(24-25)15-6-10-17(22)11-7-15/h4-11,18H,2-3,12-13H2,1H3,(H,23,26) |
| InChIKey | AJTNROOTTJXUPP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide?
The IUPAC name of N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide (CID 3042083) is N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide.
What is the SMILES notation for N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide?
The canonical SMILES for N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide is CCCCNC(=O)N1CC(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2)=N1.
What is the InChIKey of N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide?
The InChIKey is AJTNROOTTJXUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2N3O/c1-2-3-12-23-20(26)25-13-18(14-4-8-16(21)9-5-14)19(24-25)15-6-10-17(22)11-7-15/h4-11,18H,2-3,12-13H2,1H3,(H,23,26).
What are the key properties of N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide?
N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide has a molecular weight of 390.31 g/mol, XLogP of 5.31, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4,5-bis(4-chlorophenyl)-3,4-dihydropyrazole-2-carboxamide is sourced from PubChem (CID 3042083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).