About 6-ethenoxyquinoline
6-ethenoxyquinoline (PubChem CID 3042204) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 6-ethenoxyquinoline.
Molecular Properties
| Compound Name | 6-ethenoxyquinoline |
| PubChem CID | 3042204 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 6-ethenoxyquinoline |
| SMILES | C=COc1ccc2ncccc2c1 |
| InChI | InChI=1S/C11H9NO/c1-2-13-10-5-6-11-9(8-10)4-3-7-12-11/h2-8H,1H2 |
| InChIKey | STBBGXCELOSTPW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-ethenoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenoxyquinoline?
The IUPAC name of 6-ethenoxyquinoline (CID 3042204) is 6-ethenoxyquinoline.
What is the SMILES notation for 6-ethenoxyquinoline?
The canonical SMILES for 6-ethenoxyquinoline is C=COc1ccc2ncccc2c1.
What is the InChIKey of 6-ethenoxyquinoline?
The InChIKey is STBBGXCELOSTPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-2-13-10-5-6-11-9(8-10)4-3-7-12-11/h2-8H,1H2.
What are the key properties of 6-ethenoxyquinoline?
6-ethenoxyquinoline has a molecular weight of 171.20 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenoxyquinoline is sourced from PubChem (CID 3042204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).