About 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine
2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine (PubChem CID 3042227) has the molecular formula C26H31N3O4
and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine |
| PubChem CID | 3042227 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine |
| SMILES | Cc1cccc(N(CCCN2CCOCC2)c2ccncc2)c1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C19H25N3O.C7H6O3/c1-17-4-2-5-19(16-17)22(18-6-8-20-9-7-18)11-3-10-21-12-14-23-15-13-21;8-6-4-2-1-3-5(6)7(9)10/h2,4-9,16H,3,10-15H2,1H3;1-4,8H,(H,9,10) |
| InChIKey | OBGQNYRWOHVVGY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine?
The IUPAC name of 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine (CID 3042227) is 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine.
What is the SMILES notation for 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine?
The canonical SMILES for 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine is Cc1cccc(N(CCCN2CCOCC2)c2ccncc2)c1.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine?
The InChIKey is OBGQNYRWOHVVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O.C7H6O3/c1-17-4-2-5-19(16-17)22(18-6-8-20-9-7-18)11-3-10-21-12-14-23-15-13-21;8-6-4-2-1-3-5(6)7(9)10/h2,4-9,16H,3,10-15H2,1H3;1-4,8H,(H,9,10).
What are the key properties of 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine?
2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine has a molecular weight of 449.55 g/mol, XLogP of 4.34, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;N-(3-methylphenyl)-N-(3-morpholin-4-ylpropyl)pyridin-4-amine is sourced from PubChem (CID 3042227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).