C5H11N3S — CID 3042289
2,5,5-trimethyl-1,2,4-triazolidine-3-thione (PubChem CID 3042289) has the molecular formula C5H11N3S and a molecular weight of 145.23 g/mol. Its IUPAC name is 2,5,5-trimethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 2,5,5-trimethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 3042289 |
| Molecular Formula | C5H11N3S |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2,5,5-trimethyl-1,2,4-triazolidine-3-thione |
| SMILES | CN1NC(C)(C)NC1=S |
| InChI | InChI=1S/C5H11N3S/c1-5(2)6-4(9)8(3)7-5/h7H,1-3H3,(H,6,9) |
| InChIKey | ZQPPLTTUXRJVLP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|