C11H15N3S — CID 3042291
5,5-dimethyl-2-(4-methylphenyl)-1,2,4-triazolidine-3-thione (PubChem CID 3042291) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 5,5-dimethyl-2-(4-methylphenyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5,5-dimethyl-2-(4-methylphenyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 3042291 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5,5-dimethyl-2-(4-methylphenyl)-1,2,4-triazolidine-3-thione |
| SMILES | Cc1ccc(N2NC(C)(C)NC2=S)cc1 |
| InChI | InChI=1S/C11H15N3S/c1-8-4-6-9(7-5-8)14-10(15)12-11(2,3)13-14/h4-7,13H,1-3H3,(H,12,15) |
| InChIKey | BXRQHXARFRVWGE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|