C17H15N3O2 — CID 3042496
5-ethyl-6-methyl-2,3-dihydropyridazino[4,5-b]carbazole-1,4-dione (PubChem CID 3042496) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-ethyl-6-methyl-2,3-dihydropyridazino[4,5-b]carbazole-1,4-dione.
| Compound Name | 5-ethyl-6-methyl-2,3-dihydropyridazino[4,5-b]carbazole-1,4-dione |
|---|---|
| PubChem CID | 3042496 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 5-ethyl-6-methyl-2,3-dihydropyridazino[4,5-b]carbazole-1,4-dione |
| SMILES | CCc1c2c(=O)[nH][nH]c(=O)c2cc2c3ccccc3n(C)c12 |
| InChI | InChI=1S/C17H15N3O2/c1-3-9-14-12(16(21)18-19-17(14)22)8-11-10-6-4-5-7-13(10)20(2)15(9)11/h4-8H,3H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | QWTUJWJICWGIBW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |