C9H9Cl3N2O — CID 3042578
1,1-dimethyl-3-(2,4,6-trichlorophenyl)urea (PubChem CID 3042578) has the molecular formula C9H9Cl3N2O and a molecular weight of 267.54 g/mol. Its IUPAC name is 1,1-dimethyl-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1,1-dimethyl-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 3042578 |
| Molecular Formula | C9H9Cl3N2O |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 1,1-dimethyl-3-(2,4,6-trichlorophenyl)urea |
| SMILES | CN(C)C(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl3N2O/c1-14(2)9(15)13-8-6(11)3-5(10)4-7(8)12/h3-4H,1-2H3,(H,13,15) |
| InChIKey | OALYUGQHXIWDRN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |