About (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate
(3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate (PubChem CID 3042623) has the molecular formula C16H20I3NO4
and a molecular weight of 671.05 g/mol. Its IUPAC name is (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate.
Molecular Properties
| Compound Name | (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate |
| PubChem CID | 3042623 |
| Molecular Formula | C16H20I3NO4 |
| Molecular Weight | 671.05 g/mol |
| Exact Mass | 670.85 |
| IUPAC Name | (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate |
| SMILES | CCCCCCOC(=O)OCc1c(I)cc(I)c(NC(C)=O)c1I |
| InChI | InChI=1S/C16H20I3NO4/c1-3-4-5-6-7-23-16(22)24-9-11-12(17)8-13(18)15(14(11)19)20-10(2)21/h8H,3-7,9H2,1-2H3,(H,20,21) |
| InChIKey | ZBGKRYZBUUXLKF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 671.05 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate?
The IUPAC name of (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate (CID 3042623) is (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate.
What is the SMILES notation for (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate?
The canonical SMILES for (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate is CCCCCCOC(=O)OCc1c(I)cc(I)c(NC(C)=O)c1I.
What is the InChIKey of (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate?
The InChIKey is ZBGKRYZBUUXLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20I3NO4/c1-3-4-5-6-7-23-16(22)24-9-11-12(17)8-13(18)15(14(11)19)20-10(2)21/h8H,3-7,9H2,1-2H3,(H,20,21).
What are the key properties of (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate?
(3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate has a molecular weight of 671.05 g/mol, XLogP of 5.69, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamido-2,4,6-triiodophenyl)methyl hexyl carbonate is sourced from PubChem (CID 3042623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).