C10H19Br2N — CID 3042681
(1S,8S)-4-(2-bromoethyl)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium bromide (PubChem CID 3042681) has the molecular formula C10H19Br2N and a molecular weight of 313.08 g/mol. Its IUPAC name is (1S,8S)-4-(2-bromoethyl)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium bromide.
| Compound Name | (1S,8S)-4-(2-bromoethyl)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium bromide |
|---|---|
| PubChem CID | 3042681 |
| Molecular Formula | C10H19Br2N |
| Molecular Weight | 313.08 g/mol |
| Exact Mass | 310.99 |
| IUPAC Name | (1S,8S)-4-(2-bromoethyl)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium bromide |
| SMILES | C[C@H]1CC[N+]2(CCBr)CCC[C@@H]12.[Br-] |
| InChI | InChI=1S/C10H19BrN.BrH/c1-9-4-7-12(8-5-11)6-2-3-10(9)12;/h9-10H,2-8H2,1H3;1H/q+1;/p-1/t9-,10-,12?;/m0./s1 |
| InChIKey | GDHVESWQAOUBNH-WERZMDRISA-M |
| XLogP | -0.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.08 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|