About 2-octoxybenzamide
2-octoxybenzamide (PubChem CID 3042755) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-octoxybenzamide.
Molecular Properties
| Compound Name | 2-octoxybenzamide |
| PubChem CID | 3042755 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-octoxybenzamide |
| SMILES | CCCCCCCCOc1ccccc1C(N)=O |
| InChI | InChI=1S/C15H23NO2/c1-2-3-4-5-6-9-12-18-14-11-8-7-10-13(14)15(16)17/h7-8,10-11H,2-6,9,12H2,1H3,(H2,16,17) |
| InChIKey | ZYVUDNVAWMXRMR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octoxybenzamide?
The IUPAC name of 2-octoxybenzamide (CID 3042755) is 2-octoxybenzamide.
What is the SMILES notation for 2-octoxybenzamide?
The canonical SMILES for 2-octoxybenzamide is CCCCCCCCOc1ccccc1C(N)=O.
What is the InChIKey of 2-octoxybenzamide?
The InChIKey is ZYVUDNVAWMXRMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-2-3-4-5-6-9-12-18-14-11-8-7-10-13(14)15(16)17/h7-8,10-11H,2-6,9,12H2,1H3,(H2,16,17).
What are the key properties of 2-octoxybenzamide?
2-octoxybenzamide has a molecular weight of 249.35 g/mol, XLogP of 3.52, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octoxybenzamide is sourced from PubChem (CID 3042755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).