About (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol
(2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol (PubChem CID 3042770) has the molecular formula C17H27Cl2N3O4
and a molecular weight of 408.33 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol.
Molecular Properties
| Compound Name | (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol |
| PubChem CID | 3042770 |
| Molecular Formula | C17H27Cl2N3O4 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol |
| SMILES | CC(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.NCCO |
| InChI | InChI=1S/C15H20Cl2N2O3.C2H7NO/c1-11(20)18-14(15(21)22)10-12-2-4-13(5-3-12)19(8-6-16)9-7-17;3-1-2-4/h2-5,14H,6-10H2,1H3,(H,18,20)(H,21,22);4H,1-3H2/t14-;/m0./s1 |
| InChIKey | PYCNRQQUHBHABK-UQKRIMTDSA-N |
| XLogP | 1.04 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol?
The IUPAC name of (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol (CID 3042770) is (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol.
What is the SMILES notation for (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol?
The canonical SMILES for (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol is CC(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.NCCO.
What is the InChIKey of (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol?
The InChIKey is PYCNRQQUHBHABK-UQKRIMTDSA-N. The full InChI is InChI=1S/C15H20Cl2N2O3.C2H7NO/c1-11(20)18-14(15(21)22)10-12-2-4-13(5-3-12)19(8-6-16)9-7-17;3-1-2-4/h2-5,14H,6-10H2,1H3,(H,18,20)(H,21,22);4H,1-3H2/t14-;/m0./s1.
What are the key properties of (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol?
(2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol has a molecular weight of 408.33 g/mol, XLogP of 1.04, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-acetamido-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;2-aminoethanol is sourced from PubChem (CID 3042770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).