About 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid
2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid (PubChem CID 3042771) has the molecular formula C21H35Cl2N3O4
and a molecular weight of 464.43 g/mol. Its IUPAC name is 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid |
| PubChem CID | 3042771 |
| Molecular Formula | C21H35Cl2N3O4 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid |
| SMILES | CCCCCC(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.NCCO |
| InChI | InChI=1S/C19H28Cl2N2O3.C2H7NO/c1-2-3-4-5-18(24)22-17(19(25)26)14-15-6-8-16(9-7-15)23(12-10-20)13-11-21;3-1-2-4/h6-9,17H,2-5,10-14H2,1H3,(H,22,24)(H,25,26);4H,1-3H2/t17-;/m0./s1 |
| InChIKey | LJXDDBRGHBSLBW-LMOVPXPDSA-N |
| XLogP | 2.60 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid?
The IUPAC name of 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid (CID 3042771) is 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid.
What is the SMILES notation for 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid?
The canonical SMILES for 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid is CCCCCC(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.NCCO.
What is the InChIKey of 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid?
The InChIKey is LJXDDBRGHBSLBW-LMOVPXPDSA-N. The full InChI is InChI=1S/C19H28Cl2N2O3.C2H7NO/c1-2-3-4-5-18(24)22-17(19(25)26)14-15-6-8-16(9-7-15)23(12-10-20)13-11-21;3-1-2-4/h6-9,17H,2-5,10-14H2,1H3,(H,22,24)(H,25,26);4H,1-3H2/t17-;/m0./s1.
What are the key properties of 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid?
2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid has a molecular weight of 464.43 g/mol, XLogP of 2.60, 14 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(hexanoylamino)propanoic acid is sourced from PubChem (CID 3042771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).