About 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid
2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid (PubChem CID 3042773) has the molecular formula C24H41Cl2N3O4
and a molecular weight of 506.52 g/mol. Its IUPAC name is 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid |
| PubChem CID | 3042773 |
| Molecular Formula | C24H41Cl2N3O4 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid |
| SMILES | CCCCCCCCC(=O)NC(Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.NCCO |
| InChI | InChI=1S/C22H34Cl2N2O3.C2H7NO/c1-2-3-4-5-6-7-8-21(27)25-20(22(28)29)17-18-9-11-19(12-10-18)26(15-13-23)16-14-24;3-1-2-4/h9-12,20H,2-8,13-17H2,1H3,(H,25,27)(H,28,29);4H,1-3H2 |
| InChIKey | GYYWXBXKNQGXJT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid?
The IUPAC name of 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid (CID 3042773) is 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid.
What is the SMILES notation for 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid?
The canonical SMILES for 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid is CCCCCCCCC(=O)NC(Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.NCCO.
What is the InChIKey of 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid?
The InChIKey is GYYWXBXKNQGXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34Cl2N2O3.C2H7NO/c1-2-3-4-5-6-7-8-21(27)25-20(22(28)29)17-18-9-11-19(12-10-18)26(15-13-23)16-14-24;3-1-2-4/h9-12,20H,2-8,13-17H2,1H3,(H,25,27)(H,28,29);4H,1-3H2.
What are the key properties of 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid?
2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid has a molecular weight of 506.52 g/mol, XLogP of 3.77, 17 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;3-[4-[bis(2-chloroethyl)amino]phenyl]-2-(nonanoylamino)propanoic acid is sourced from PubChem (CID 3042773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).