About N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride
N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride (PubChem CID 3042831) has the molecular formula C10H14ClNO
and a molecular weight of 199.68 g/mol. Its IUPAC name is N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| PubChem CID | 3042831 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| SMILES | CNC1COc2ccccc2C1.Cl |
| InChI | InChI=1S/C10H13NO.ClH/c1-11-9-6-8-4-2-3-5-10(8)12-7-9;/h2-5,9,11H,6-7H2,1H3;1H |
| InChIKey | YDHFWKMNFCKUBH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The IUPAC name of N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride (CID 3042831) is N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride.
What is the SMILES notation for N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The canonical SMILES for N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride is CNC1COc2ccccc2C1.Cl.
What is the InChIKey of N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
The InChIKey is YDHFWKMNFCKUBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.ClH/c1-11-9-6-8-4-2-3-5-10(8)12-7-9;/h2-5,9,11H,6-7H2,1H3;1H.
What are the key properties of N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride?
N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride has a molecular weight of 199.68 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3,4-dihydro-2H-chromen-3-amine;hydrochloride is sourced from PubChem (CID 3042831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).