About (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride
(2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride (PubChem CID 3042844) has the molecular formula C8H13ClN2O2S
and a molecular weight of 236.72 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride.
Molecular Properties
| Compound Name | (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride |
| PubChem CID | 3042844 |
| Molecular Formula | C8H13ClN2O2S |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride |
| SMILES | Cc1ncc(COC(=O)N(C)C)s1.Cl |
| InChI | InChI=1S/C8H12N2O2S.ClH/c1-6-9-4-7(13-6)5-12-8(11)10(2)3;/h4H,5H2,1-3H3;1H |
| InChIKey | TYMROVGZPYNGBN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride?
The IUPAC name of (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride (CID 3042844) is (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride.
What is the SMILES notation for (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride?
The canonical SMILES for (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride is Cc1ncc(COC(=O)N(C)C)s1.Cl.
What is the InChIKey of (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride?
The InChIKey is TYMROVGZPYNGBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S.ClH/c1-6-9-4-7(13-6)5-12-8(11)10(2)3;/h4H,5H2,1-3H3;1H.
What are the key properties of (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride?
(2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride has a molecular weight of 236.72 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-thiazol-5-yl)methyl N,N-dimethylcarbamate;hydrochloride is sourced from PubChem (CID 3042844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).