About 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate
3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate (PubChem CID 3042848) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate.
Molecular Properties
| Compound Name | 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate |
| PubChem CID | 3042848 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCc1cnc(C)s1 |
| InChI | InChI=1S/C9H14N2O2S/c1-7-11-6-8(14-7)4-3-5-13-9(12)10-2/h6H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | LQWQKHVJTULDNN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate?
The IUPAC name of 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate (CID 3042848) is 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate.
What is the SMILES notation for 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate?
The canonical SMILES for 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate is CNC(=O)OCCCc1cnc(C)s1.
What is the InChIKey of 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate?
The InChIKey is LQWQKHVJTULDNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-7-11-6-8(14-7)4-3-5-13-9(12)10-2/h6H,3-5H2,1-2H3,(H,10,12).
What are the key properties of 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate?
3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate has a molecular weight of 214.29 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-thiazol-5-yl)propyl N-methylcarbamate is sourced from PubChem (CID 3042848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).