C14H26BrN — CID 3042899
4-hexan-3-yl-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide (PubChem CID 3042899) has the molecular formula C14H26BrN and a molecular weight of 288.27 g/mol. Its IUPAC name is 4-hexan-3-yl-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide.
| Compound Name | 4-hexan-3-yl-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide |
|---|---|
| PubChem CID | 3042899 |
| Molecular Formula | C14H26BrN |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-hexan-3-yl-7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-4-ium bromide |
| SMILES | C=C1CC[N+]2(C(CC)CCC)CCCC12.[Br-] |
| InChI | InChI=1S/C14H26N.BrH/c1-4-7-13(5-2)15-10-6-8-14(15)12(3)9-11-15;/h13-14H,3-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WNRNWUPCIJVVHD-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|