About [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate
[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate (PubChem CID 30429) has the molecular formula C19H27FN2O3
and a molecular weight of 350.43 g/mol. Its IUPAC name is [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate |
| PubChem CID | 30429 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)OC1CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN2O3/c1-14(2)21-19(24)25-17-9-12-22(13-10-17)11-3-4-18(23)15-5-7-16(20)8-6-15/h5-8,14,17H,3-4,9-13H2,1-2H3,(H,21,24) |
| InChIKey | HJSFDYCHYVGVDC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate?
The IUPAC name of [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate (CID 30429) is [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate.
What is the SMILES notation for [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate?
The canonical SMILES for [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate is CC(C)NC(=O)OC1CCN(CCCC(=O)c2ccc(F)cc2)CC1.
What is the InChIKey of [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate?
The InChIKey is HJSFDYCHYVGVDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27FN2O3/c1-14(2)21-19(24)25-17-9-12-22(13-10-17)11-3-4-18(23)15-5-7-16(20)8-6-15/h5-8,14,17H,3-4,9-13H2,1-2H3,(H,21,24).
What are the key properties of [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate?
[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate has a molecular weight of 350.43 g/mol, XLogP of 3.39, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] N-propan-2-ylcarbamate is sourced from PubChem (CID 30429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).