C20H30ClF3N2S — CID 3043036
N,N-diethyl-2-[2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazin-11-yl]ethanamine;hydrochloride (PubChem CID 3043036) has the molecular formula C20H30ClF3N2S and a molecular weight of 422.99 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazin-11-yl]ethanamine;hydrochloride.
| Compound Name | N,N-diethyl-2-[2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazin-11-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 3043036 |
| Molecular Formula | C20H30ClF3N2S |
| Molecular Weight | 422.99 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N,N-diethyl-2-[2-(trifluoromethyl)-6,7,8,9,10,10a-hexahydro-5aH-cyclohepta[b][1,4]benzothiazin-11-yl]ethanamine;hydrochloride |
| SMILES | CCN(CC)CCN1c2cc(C(F)(F)F)ccc2SC2CCCCCC21.Cl |
| InChI | InChI=1S/C20H29F3N2S.ClH/c1-3-24(4-2)12-13-25-16-8-6-5-7-9-18(16)26-19-11-10-15(14-17(19)25)20(21,22)23;/h10-11,14,16,18H,3-9,12-13H2,1-2H3;1H |
| InChIKey | SESJWTVAXGWWAK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.99 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |