About N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride
N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride (PubChem CID 3043200) has the molecular formula C19H22BrClN2
and a molecular weight of 393.76 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 3043200 |
| Molecular Formula | C19H22BrClN2 |
| Molecular Weight | 393.76 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride |
| SMILES | Brc1ccc(N/C(=N/C2CCCCC2)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H21BrN2.ClH/c20-16-11-13-18(14-12-16)22-19(15-7-3-1-4-8-15)21-17-9-5-2-6-10-17;/h1,3-4,7-8,11-14,17H,2,5-6,9-10H2,(H,21,22);1H |
| InChIKey | QGYSGQRATLQLFU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
The IUPAC name of N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride (CID 3043200) is N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride is Brc1ccc(N/C(=N/C2CCCCC2)c2ccccc2)cc1.Cl.
What is the InChIKey of N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
The InChIKey is QGYSGQRATLQLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21BrN2.ClH/c20-16-11-13-18(14-12-16)22-19(15-7-3-1-4-8-15)21-17-9-5-2-6-10-17;/h1,3-4,7-8,11-14,17H,2,5-6,9-10H2,(H,21,22);1H.
What are the key properties of N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride has a molecular weight of 393.76 g/mol, XLogP of 6.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-N'-cyclohexylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 3043200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).