About N-tert-butyl-2-hydroxy-2,2-diphenylacetamide
N-tert-butyl-2-hydroxy-2,2-diphenylacetamide (PubChem CID 3043222) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is N-tert-butyl-2-hydroxy-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-hydroxy-2,2-diphenylacetamide |
| PubChem CID | 3043222 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-tert-butyl-2-hydroxy-2,2-diphenylacetamide |
| SMILES | CC(C)(C)NC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-17(2,3)19-16(20)18(21,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,21H,1-3H3,(H,19,20) |
| InChIKey | BPBMYZSXEMWTHM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-2-hydroxy-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-hydroxy-2,2-diphenylacetamide?
The IUPAC name of N-tert-butyl-2-hydroxy-2,2-diphenylacetamide (CID 3043222) is N-tert-butyl-2-hydroxy-2,2-diphenylacetamide.
What is the SMILES notation for N-tert-butyl-2-hydroxy-2,2-diphenylacetamide?
The canonical SMILES for N-tert-butyl-2-hydroxy-2,2-diphenylacetamide is CC(C)(C)NC(=O)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-tert-butyl-2-hydroxy-2,2-diphenylacetamide?
The InChIKey is BPBMYZSXEMWTHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-17(2,3)19-16(20)18(21,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,21H,1-3H3,(H,19,20).
What are the key properties of N-tert-butyl-2-hydroxy-2,2-diphenylacetamide?
N-tert-butyl-2-hydroxy-2,2-diphenylacetamide has a molecular weight of 283.37 g/mol, XLogP of 2.84, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-hydroxy-2,2-diphenylacetamide is sourced from PubChem (CID 3043222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).