About 3-propylhexanamide
3-propylhexanamide (PubChem CID 3043304) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 3-propylhexanamide.
Molecular Properties
| Compound Name | 3-propylhexanamide |
| PubChem CID | 3043304 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 3-propylhexanamide |
| SMILES | CCCC(CCC)CC(N)=O |
| InChI | InChI=1S/C9H19NO/c1-3-5-8(6-4-2)7-9(10)11/h8H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | KAACLWQGBIEOGR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylhexanamide?
The IUPAC name of 3-propylhexanamide (CID 3043304) is 3-propylhexanamide.
What is the SMILES notation for 3-propylhexanamide?
The canonical SMILES for 3-propylhexanamide is CCCC(CCC)CC(N)=O.
What is the InChIKey of 3-propylhexanamide?
The InChIKey is KAACLWQGBIEOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-3-5-8(6-4-2)7-9(10)11/h8H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 3-propylhexanamide?
3-propylhexanamide has a molecular weight of 157.26 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylhexanamide is sourced from PubChem (CID 3043304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).