C21H22F2N2O4 — CID 30433077
1-(2,4-difluorobenzoyl)-N-(2,4-dimethoxyphenyl)piperidine-4-carboxamide (PubChem CID 30433077) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is 1-(2,4-difluorobenzoyl)-N-(2,4-dimethoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,4-difluorobenzoyl)-N-(2,4-dimethoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30433077 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-(2,4-difluorobenzoyl)-N-(2,4-dimethoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCN(C(=O)c3ccc(F)cc3F)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H22F2N2O4/c1-28-15-4-6-18(19(12-15)29-2)24-20(26)13-7-9-25(10-8-13)21(27)16-5-3-14(22)11-17(16)23/h3-6,11-13H,7-10H2,1-2H3,(H,24,26) |
| InChIKey | XIFWMFBKSCBPLF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |