C16H20Cl4N2O2 — CID 3043329
4-[[2,3,5,6-tetrachloro-4-(morpholin-4-ylmethyl)phenyl]methyl]morpholine (PubChem CID 3043329) has the molecular formula C16H20Cl4N2O2 and a molecular weight of 414.16 g/mol. Its IUPAC name is 4-[[2,3,5,6-tetrachloro-4-(morpholin-4-ylmethyl)phenyl]methyl]morpholine.
| Compound Name | 4-[[2,3,5,6-tetrachloro-4-(morpholin-4-ylmethyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 3043329 |
| Molecular Formula | C16H20Cl4N2O2 |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 4-[[2,3,5,6-tetrachloro-4-(morpholin-4-ylmethyl)phenyl]methyl]morpholine |
| SMILES | Clc1c(Cl)c(CN2CCOCC2)c(Cl)c(Cl)c1CN1CCOCC1 |
| InChI | InChI=1S/C16H20Cl4N2O2/c17-13-11(9-21-1-5-23-6-2-21)14(18)16(20)12(15(13)19)10-22-3-7-24-8-4-22/h1-10H2 |
| InChIKey | DKKDOKUKTDDOHB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|