C6H9N5S — CID 3043397
1-prop-2-enyl-3-(1H-1,2,4-triazol-5-yl)thiourea (PubChem CID 3043397) has the molecular formula C6H9N5S and a molecular weight of 183.24 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(1H-1,2,4-triazol-5-yl)thiourea.
| Compound Name | 1-prop-2-enyl-3-(1H-1,2,4-triazol-5-yl)thiourea |
|---|---|
| PubChem CID | 3043397 |
| Molecular Formula | C6H9N5S |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 1-prop-2-enyl-3-(1H-1,2,4-triazol-5-yl)thiourea |
| SMILES | C=CCNC(=S)Nc1ncn[nH]1 |
| InChI | InChI=1S/C6H9N5S/c1-2-3-7-6(12)10-5-8-4-9-11-5/h2,4H,1,3H2,(H3,7,8,9,10,11,12) |
| InChIKey | AMOJSCPRAQMBCM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|