About 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline
2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline (PubChem CID 3043511) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline.
Molecular Properties
| Compound Name | 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline |
| PubChem CID | 3043511 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline |
| SMILES | c1ccc(-c2cn3c(n2)Cc2ccccc2C3)cc1 |
| InChI | InChI=1S/C17H14N2/c1-2-6-13(7-3-1)16-12-19-11-15-9-5-4-8-14(15)10-17(19)18-16/h1-9,12H,10-11H2 |
| InChIKey | DDWDZCICYJSYMP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline?
The IUPAC name of 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline (CID 3043511) is 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline.
What is the SMILES notation for 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline?
The canonical SMILES for 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline is c1ccc(-c2cn3c(n2)Cc2ccccc2C3)cc1.
What is the InChIKey of 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline?
The InChIKey is DDWDZCICYJSYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2/c1-2-6-13(7-3-1)16-12-19-11-15-9-5-4-8-14(15)10-17(19)18-16/h1-9,12H,10-11H2.
What are the key properties of 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline?
2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline has a molecular weight of 246.31 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5,10-dihydroimidazo[1,2-b]isoquinoline is sourced from PubChem (CID 3043511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).