C10H13N5O — CID 3043537
4-(1H-imidazo[4,5-b]pyrazin-2-ylmethyl)morpholine (PubChem CID 3043537) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 4-(1H-imidazo[4,5-b]pyrazin-2-ylmethyl)morpholine.
| Compound Name | 4-(1H-imidazo[4,5-b]pyrazin-2-ylmethyl)morpholine |
|---|---|
| PubChem CID | 3043537 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-(1H-imidazo[4,5-b]pyrazin-2-ylmethyl)morpholine |
| SMILES | c1cnc2[nH]c(CN3CCOCC3)nc2n1 |
| InChI | InChI=1S/C10H13N5O/c1-2-12-10-9(11-1)13-8(14-10)7-15-3-5-16-6-4-15/h1-2H,3-7H2,(H,11,12,13,14) |
| InChIKey | CLRHLXOEUKQYBI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |