About 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione
3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione (PubChem CID 3043579) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione.
Molecular Properties
| Compound Name | 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione |
| PubChem CID | 3043579 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione |
| SMILES | CCC1(CC)C(=O)NC=C(CN2CCCCC2)C1=O |
| InChI | InChI=1S/C15H24N2O2/c1-3-15(4-2)13(18)12(10-16-14(15)19)11-17-8-6-5-7-9-17/h10H,3-9,11H2,1-2H3,(H,16,19) |
| InChIKey | UJRAOQWICDYDFV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione?
The IUPAC name of 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione (CID 3043579) is 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione.
What is the SMILES notation for 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione?
The canonical SMILES for 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione is CCC1(CC)C(=O)NC=C(CN2CCCCC2)C1=O.
What is the InChIKey of 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione?
The InChIKey is UJRAOQWICDYDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-3-15(4-2)13(18)12(10-16-14(15)19)11-17-8-6-5-7-9-17/h10H,3-9,11H2,1-2H3,(H,16,19).
What are the key properties of 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione?
3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione has a molecular weight of 264.37 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-5-(piperidin-1-ylmethyl)-1H-pyridine-2,4-dione is sourced from PubChem (CID 3043579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).