About 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride
4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride (PubChem CID 3043611) has the molecular formula C11H20Cl2N2
and a molecular weight of 251.20 g/mol. Its IUPAC name is 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride.
Molecular Properties
| Compound Name | 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride |
| PubChem CID | 3043611 |
| Molecular Formula | C11H20Cl2N2 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride |
| SMILES | CC(N)Cc1ccc(N(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C11H18N2.2ClH/c1-9(12)8-10-4-6-11(7-5-10)13(2)3;;/h4-7,9H,8,12H2,1-3H3;2*1H |
| InChIKey | NWQNCALMMPMUFF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride?
The IUPAC name of 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride (CID 3043611) is 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride.
What is the SMILES notation for 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride?
The canonical SMILES for 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride is CC(N)Cc1ccc(N(C)C)cc1.Cl.Cl.
What is the InChIKey of 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride?
The InChIKey is NWQNCALMMPMUFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2.2ClH/c1-9(12)8-10-4-6-11(7-5-10)13(2)3;;/h4-7,9H,8,12H2,1-3H3;2*1H.
What are the key properties of 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride?
4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride has a molecular weight of 251.20 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)-N,N-dimethylaniline;dihydrochloride is sourced from PubChem (CID 3043611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).