About 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride
4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride (PubChem CID 3043613) has the molecular formula C11H19BrCl2N2
and a molecular weight of 330.10 g/mol. Its IUPAC name is 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride.
Molecular Properties
| Compound Name | 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride |
| PubChem CID | 3043613 |
| Molecular Formula | C11H19BrCl2N2 |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride |
| SMILES | CC(N)Cc1ccc(N(C)C)c(Br)c1.Cl.Cl |
| InChI | InChI=1S/C11H17BrN2.2ClH/c1-8(13)6-9-4-5-11(14(2)3)10(12)7-9;;/h4-5,7-8H,6,13H2,1-3H3;2*1H |
| InChIKey | NWZHZXQLJMBQQL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride?
The IUPAC name of 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride (CID 3043613) is 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride.
What is the SMILES notation for 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride?
The canonical SMILES for 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride is CC(N)Cc1ccc(N(C)C)c(Br)c1.Cl.Cl.
What is the InChIKey of 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride?
The InChIKey is NWZHZXQLJMBQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17BrN2.2ClH/c1-8(13)6-9-4-5-11(14(2)3)10(12)7-9;;/h4-5,7-8H,6,13H2,1-3H3;2*1H.
What are the key properties of 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride?
4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride has a molecular weight of 330.10 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)-2-bromo-N,N-dimethylaniline;dihydrochloride is sourced from PubChem (CID 3043613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).