About 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride
1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride (PubChem CID 3043615) has the molecular formula C13H22Cl2N2
and a molecular weight of 277.24 g/mol. Its IUPAC name is 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride |
| PubChem CID | 3043615 |
| Molecular Formula | C13H22Cl2N2 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride |
| SMILES | CC(N)Cc1ccc2c(c1)CCCN2C.Cl.Cl |
| InChI | InChI=1S/C13H20N2.2ClH/c1-10(14)8-11-5-6-13-12(9-11)4-3-7-15(13)2;;/h5-6,9-10H,3-4,7-8,14H2,1-2H3;2*1H |
| InChIKey | TVJDQAJNZZLLOS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride?
The IUPAC name of 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride (CID 3043615) is 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride.
What is the SMILES notation for 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride?
The canonical SMILES for 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride is CC(N)Cc1ccc2c(c1)CCCN2C.Cl.Cl.
What is the InChIKey of 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride?
The InChIKey is TVJDQAJNZZLLOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2.2ClH/c1-10(14)8-11-5-6-13-12(9-11)4-3-7-15(13)2;;/h5-6,9-10H,3-4,7-8,14H2,1-2H3;2*1H.
What are the key properties of 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride?
1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride has a molecular weight of 277.24 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)propan-2-amine;dihydrochloride is sourced from PubChem (CID 3043615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).