C12H15NO2 — CID 3043713
N-(7-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide (PubChem CID 3043713) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(7-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide.
| Compound Name | N-(7-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide |
|---|---|
| PubChem CID | 3043713 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-(7-methyl-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)formamide |
| SMILES | Cc1ccc2c(c1)C(NC=O)CCCO2 |
| InChI | InChI=1S/C12H15NO2/c1-9-4-5-12-10(7-9)11(13-8-14)3-2-6-15-12/h4-5,7-8,11H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | ABKCRQCDLGFNJK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|